4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid

C10H17NO5 — CID 76992948

IUPAC4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid
SMILESCOC(CNC(=O)C(C)=C(C)C(=O)O)OC
InChIInChI=1S/C10H17NO5/c1-6(7(2)10(13)14)9(12)11-5-8(15-3)16-4/h8H,5H2,1-4H3,(H,11,12)(H,13,14)
InChIKeyYXLYERQTSPPPBJ-UHFFFAOYSA-N
MW231.25 g/mol
LogP0.14
Rot. Bonds6

About 4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid

4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 76992948) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid
PubChem CID76992948
Molecular FormulaC10H17NO5
Molecular Weight231.25 g/mol
Exact Mass231.11
IUPAC Name4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid
SMILESCOC(CNC(=O)C(C)=C(C)C(=O)O)OC
InChIInChI=1S/C10H17NO5/c1-6(7(2)10(13)14)9(12)11-5-8(15-3)16-4/h8H,5H2,1-4H3,(H,11,12)(H,13,14)
InChIKeyYXLYERQTSPPPBJ-UHFFFAOYSA-N
XLogP0.14
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.25
LogP ≤ 50.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid?
The IUPAC name of 4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid (CID 76992948) is 4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid.
What is the SMILES notation for 4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid?
The canonical SMILES for 4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid is COC(CNC(=O)C(C)=C(C)C(=O)O)OC.
What is the InChIKey of 4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid?
The InChIKey is YXLYERQTSPPPBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO5/c1-6(7(2)10(13)14)9(12)11-5-8(15-3)16-4/h8H,5H2,1-4H3,(H,11,12)(H,13,14).
What are the key properties of 4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid?
4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid has a molecular weight of 231.25 g/mol, XLogP of 0.14, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid is sourced from PubChem (CID 76992948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).