C10H17NO5 — CID 76992948
4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 76992948) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76992948 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 4-(2,2-dimethoxyethylamino)-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | COC(CNC(=O)C(C)=C(C)C(=O)O)OC |
| InChI | InChI=1S/C10H17NO5/c1-6(7(2)10(13)14)9(12)11-5-8(15-3)16-4/h8H,5H2,1-4H3,(H,11,12)(H,13,14) |
| InChIKey | YXLYERQTSPPPBJ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|