C10H15NO6 — CID 107214916
4-[(2-hydroxy-3-methoxy-3-oxopropyl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 107214916) has the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. Its IUPAC name is 4-[(2-hydroxy-3-methoxy-3-oxopropyl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-[(2-hydroxy-3-methoxy-3-oxopropyl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 107214916 |
| Molecular Formula | C10H15NO6 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 4-[(2-hydroxy-3-methoxy-3-oxopropyl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | COC(=O)C(O)CNC(=O)C(C)=C(C)C(=O)O |
| InChI | InChI=1S/C10H15NO6/c1-5(6(2)9(14)15)8(13)11-4-7(12)10(16)17-3/h7,12H,4H2,1-3H3,(H,11,13)(H,14,15) |
| InChIKey | UXPKDYNBUDKXLJ-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|