C7H9F4NO4 — CID 103958229
methyl 2-hydroxy-3-(2,2,3,3-tetrafluoropropanoylamino)propanoate (PubChem CID 103958229) has the molecular formula C7H9F4NO4 and a molecular weight of 247.14 g/mol. Its IUPAC name is methyl 2-hydroxy-3-(2,2,3,3-tetrafluoropropanoylamino)propanoate.
| Compound Name | methyl 2-hydroxy-3-(2,2,3,3-tetrafluoropropanoylamino)propanoate |
|---|---|
| PubChem CID | 103958229 |
| Molecular Formula | C7H9F4NO4 |
| Molecular Weight | 247.14 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | methyl 2-hydroxy-3-(2,2,3,3-tetrafluoropropanoylamino)propanoate |
| SMILES | COC(=O)C(O)CNC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H9F4NO4/c1-16-4(14)3(13)2-12-6(15)7(10,11)5(8)9/h3,5,13H,2H2,1H3,(H,12,15) |
| InChIKey | SFJAGPLFUKRMKJ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.14 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|