C7H13ClF4N2O — CID 119627588
N-(2-amino-2-methylpropyl)-2,2,3,3-tetrafluoropropanamide;hydrochloride (PubChem CID 119627588) has the molecular formula C7H13ClF4N2O and a molecular weight of 252.64 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-2,2,3,3-tetrafluoropropanamide;hydrochloride.
| Compound Name | N-(2-amino-2-methylpropyl)-2,2,3,3-tetrafluoropropanamide;hydrochloride |
|---|---|
| PubChem CID | 119627588 |
| Molecular Formula | C7H13ClF4N2O |
| Molecular Weight | 252.64 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-2,2,3,3-tetrafluoropropanamide;hydrochloride |
| SMILES | CC(C)(N)CNC(=O)C(F)(F)C(F)F.Cl |
| InChI | InChI=1S/C7H12F4N2O.ClH/c1-6(2,12)3-13-5(14)7(10,11)4(8)9;/h4H,3,12H2,1-2H3,(H,13,14);1H |
| InChIKey | VRKVEMVTGMGGNI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.64 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|