C9H14F4N2O2 — CID 113250804
N-[2-(tert-butylamino)-2-oxoethyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 113250804) has the molecular formula C9H14F4N2O2 and a molecular weight of 258.21 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 113250804 |
| Molecular Formula | C9H14F4N2O2 |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | CC(C)(C)NC(=O)CNC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H14F4N2O2/c1-8(2,3)15-5(16)4-14-7(17)9(12,13)6(10)11/h6H,4H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | IGRYFQSMXSFMLF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|