C10H16F4N2O2 — CID 103732251
N-[2-(tert-butylamino)-2-oxoethyl]-2,2,3,3-tetrafluoro-N-methylpropanamide (PubChem CID 103732251) has the molecular formula C10H16F4N2O2 and a molecular weight of 272.24 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-2,2,3,3-tetrafluoro-N-methylpropanamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-2,2,3,3-tetrafluoro-N-methylpropanamide |
|---|---|
| PubChem CID | 103732251 |
| Molecular Formula | C10H16F4N2O2 |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-2,2,3,3-tetrafluoro-N-methylpropanamide |
| SMILES | CN(CC(=O)NC(C)(C)C)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H16F4N2O2/c1-9(2,3)15-6(17)5-16(4)8(18)10(13,14)7(11)12/h7H,5H2,1-4H3,(H,15,17) |
| InChIKey | AJSFJUALQYQOBM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|