C10H14F4N2O2 — CID 103732271
2,2,3,3-tetrafluoro-N-methyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)propanamide (PubChem CID 103732271) has the molecular formula C10H14F4N2O2 and a molecular weight of 270.23 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-methyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-methyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 103732271 |
| Molecular Formula | C10H14F4N2O2 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-methyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)propanamide |
| SMILES | CN(CC(=O)N1CCCC1)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H14F4N2O2/c1-15(9(18)10(13,14)8(11)12)6-7(17)16-4-2-3-5-16/h8H,2-6H2,1H3 |
| InChIKey | WQTAWQXBOFYRCB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|