C8H13F4NO2 — CID 103755692
2,2,3,3-tetrafluoro-N-(2-hydroxy-2-methylpropyl)-N-methylpropanamide (PubChem CID 103755692) has the molecular formula C8H13F4NO2 and a molecular weight of 231.19 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(2-hydroxy-2-methylpropyl)-N-methylpropanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(2-hydroxy-2-methylpropyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 103755692 |
| Molecular Formula | C8H13F4NO2 |
| Molecular Weight | 231.19 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(2-hydroxy-2-methylpropyl)-N-methylpropanamide |
| SMILES | CN(CC(C)(C)O)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H13F4NO2/c1-7(2,15)4-13(3)6(14)8(11,12)5(9)10/h5,15H,4H2,1-3H3 |
| InChIKey | CGZDGGACECRKEG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|