C10H21NO3 — CID 112696432
N-(2-hydroxy-2-methylpropyl)-N-methyl-2-propan-2-yloxyacetamide (PubChem CID 112696432) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is N-(2-hydroxy-2-methylpropyl)-N-methyl-2-propan-2-yloxyacetamide.
| Compound Name | N-(2-hydroxy-2-methylpropyl)-N-methyl-2-propan-2-yloxyacetamide |
|---|---|
| PubChem CID | 112696432 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | N-(2-hydroxy-2-methylpropyl)-N-methyl-2-propan-2-yloxyacetamide |
| SMILES | CC(C)OCC(=O)N(C)CC(C)(C)O |
| InChI | InChI=1S/C10H21NO3/c1-8(2)14-6-9(12)11(5)7-10(3,4)13/h8,13H,6-7H2,1-5H3 |
| InChIKey | ATCZPXGXMZEXOE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |