C11H24N2O2 — CID 79380358
2-(tert-butylamino)-N-(2-hydroxy-2-methylpropyl)-N-methylacetamide (PubChem CID 79380358) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-(tert-butylamino)-N-(2-hydroxy-2-methylpropyl)-N-methylacetamide.
| Compound Name | 2-(tert-butylamino)-N-(2-hydroxy-2-methylpropyl)-N-methylacetamide |
|---|---|
| PubChem CID | 79380358 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 2-(tert-butylamino)-N-(2-hydroxy-2-methylpropyl)-N-methylacetamide |
| SMILES | CN(CC(C)(C)O)C(=O)CNC(C)(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-10(2,3)12-7-9(14)13(6)8-11(4,5)15/h12,15H,7-8H2,1-6H3 |
| InChIKey | DKSMIEYISASKTR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |