C18H36N2O3 — CID 170359734
N-methyl-N-[[methyl-(2,4,4,5-tetramethyl-3-oxohexyl)amino]methyl]-2-propan-2-yloxyacetamide (PubChem CID 170359734) has the molecular formula C18H36N2O3 and a molecular weight of 328.50 g/mol. Its IUPAC name is N-methyl-N-[[methyl-(2,4,4,5-tetramethyl-3-oxohexyl)amino]methyl]-2-propan-2-yloxyacetamide.
| Compound Name | N-methyl-N-[[methyl-(2,4,4,5-tetramethyl-3-oxohexyl)amino]methyl]-2-propan-2-yloxyacetamide |
|---|---|
| PubChem CID | 170359734 |
| Molecular Formula | C18H36N2O3 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.27 |
| IUPAC Name | N-methyl-N-[[methyl-(2,4,4,5-tetramethyl-3-oxohexyl)amino]methyl]-2-propan-2-yloxyacetamide |
| SMILES | CC(C)OCC(=O)N(C)CN(C)CC(C)C(=O)C(C)(C)C(C)C |
| InChI | InChI=1S/C18H36N2O3/c1-13(2)18(6,7)17(22)15(5)10-19(8)12-20(9)16(21)11-23-14(3)4/h13-15H,10-12H2,1-9H3 |
| InChIKey | JCLWLNFJDIDWSE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|