C9H12F7NO — CID 103733287
2,2,3,3-tetrafluoro-N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 103733287) has the molecular formula C9H12F7NO and a molecular weight of 283.19 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 103733287 |
| Molecular Formula | C9H12F7NO |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(2-methylpropyl)-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(C)CN(CC(F)(F)F)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H12F7NO/c1-5(2)3-17(4-8(12,13)14)7(18)9(15,16)6(10)11/h5-6H,3-4H2,1-2H3 |
| InChIKey | OVVUAROLJQXMII-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|