C11H20N2O3 — CID 60951663
N-[2-(tert-butylamino)-2-oxoethyl]-N-methyl-3-oxobutanamide (PubChem CID 60951663) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-N-methyl-3-oxobutanamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-N-methyl-3-oxobutanamide |
|---|---|
| PubChem CID | 60951663 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-N-methyl-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)N(C)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H20N2O3/c1-8(14)6-10(16)13(5)7-9(15)12-11(2,3)4/h6-7H2,1-5H3,(H,12,15) |
| InChIKey | QWFHXBIVYJFRIY-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|