C10H16N2O3 — CID 43579629
N-[2-(cyclopropylamino)-2-oxoethyl]-N-methyl-3-oxobutanamide (PubChem CID 43579629) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is N-[2-(cyclopropylamino)-2-oxoethyl]-N-methyl-3-oxobutanamide.
| Compound Name | N-[2-(cyclopropylamino)-2-oxoethyl]-N-methyl-3-oxobutanamide |
|---|---|
| PubChem CID | 43579629 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | N-[2-(cyclopropylamino)-2-oxoethyl]-N-methyl-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)N(C)CC(=O)NC1CC1 |
| InChI | InChI=1S/C10H16N2O3/c1-7(13)5-10(15)12(2)6-9(14)11-8-3-4-8/h8H,3-6H2,1-2H3,(H,11,14) |
| InChIKey | LWUFSWYDXAJMOU-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|