C7H14N4O2 — CID 76944463
N-cyclopropyl-2-[(N'-hydroxycarbamimidoyl)-methylamino]acetamide (PubChem CID 76944463) has the molecular formula C7H14N4O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is N-cyclopropyl-2-[(N'-hydroxycarbamimidoyl)-methylamino]acetamide.
| Compound Name | N-cyclopropyl-2-[(N'-hydroxycarbamimidoyl)-methylamino]acetamide |
|---|---|
| PubChem CID | 76944463 |
| Molecular Formula | C7H14N4O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | N-cyclopropyl-2-[(N'-hydroxycarbamimidoyl)-methylamino]acetamide |
| SMILES | CN(CC(=O)NC1CC1)C(N)=NO |
| InChI | InChI=1S/C7H14N4O2/c1-11(7(8)10-13)4-6(12)9-5-2-3-5/h5,13H,2-4H2,1H3,(H2,8,10)(H,9,12) |
| InChIKey | ZVSOSHJUOXPKTF-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|