C10H23Cl2N3O — CID 86277381
N-(4-aminocyclohexyl)-2-(dimethylamino)acetamide;dihydrochloride (PubChem CID 86277381) has the molecular formula C10H23Cl2N3O and a molecular weight of 272.22 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-(dimethylamino)acetamide;dihydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-2-(dimethylamino)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 86277381 |
| Molecular Formula | C10H23Cl2N3O |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-(dimethylamino)acetamide;dihydrochloride |
| SMILES | CN(C)CC(=O)NC1CCC(N)CC1.Cl.Cl |
| InChI | InChI=1S/C10H21N3O.2ClH/c1-13(2)7-10(14)12-9-5-3-8(11)4-6-9;;/h8-9H,3-7,11H2,1-2H3,(H,12,14);2*1H |
| InChIKey | JYQLETFKTKSITP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |