C36H72N8O6 — CID 161291088
N-(4-aminocyclohexyl)-2-(dimethylamino)acetamide;tert-butyl N-(4-aminocyclohexyl)carbamate;tert-butyl N-[4-[[2-(dimethylamino)acetyl]amino]cyclohexyl]carbamate (PubChem CID 161291088) has the molecular formula C36H72N8O6 and a molecular weight of 713.02 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-(dimethylamino)acetamide;tert-butyl N-(4-aminocyclohexyl)carbamate;tert-butyl N-[4-[[2-(dimethylamino)acetyl]amino]cyclohexyl]carbamate.
| Compound Name | N-(4-aminocyclohexyl)-2-(dimethylamino)acetamide;tert-butyl N-(4-aminocyclohexyl)carbamate;tert-butyl N-[4-[[2-(dimethylamino)acetyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 161291088 |
| Molecular Formula | C36H72N8O6 |
| Molecular Weight | 713.02 g/mol |
| Exact Mass | 712.56 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-(dimethylamino)acetamide;tert-butyl N-(4-aminocyclohexyl)carbamate;tert-butyl N-[4-[[2-(dimethylamino)acetyl]amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(N)CC1.CN(C)CC(=O)NC1CCC(N)CC1.CN(C)CC(=O)NC1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H29N3O3.C11H22N2O2.C10H21N3O/c1-15(2,3)21-14(20)17-12-8-6-11(7-9-12)16-13(19)10-18(4)5;1-11(2,3)15-10(14)13-9-6-4-8(12)5-7-9;1-13(2)7-10(14)12-9-5-3-8(11)4-6-9/h11-12H,6-10H2,1-5H3,(H,16,19)(H,17,20);8-9H,4-7,12H2,1-3H3,(H,13,14);8-9H,3-7,11H2,1-2H3,(H,12,14) |
| InChIKey | VGIVENGXHFPYFU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 193.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.02 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |