C27H52N2O9 — CID 160880979
4-aminocyclohexan-1-ol;tert-butyl N-(4-hydroxycyclohexyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate (PubChem CID 160880979) has the molecular formula C27H52N2O9 and a molecular weight of 548.72 g/mol. Its IUPAC name is 4-aminocyclohexan-1-ol;tert-butyl N-(4-hydroxycyclohexyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate.
| Compound Name | 4-aminocyclohexan-1-ol;tert-butyl N-(4-hydroxycyclohexyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
|---|---|
| PubChem CID | 160880979 |
| Molecular Formula | C27H52N2O9 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.37 |
| IUPAC Name | 4-aminocyclohexan-1-ol;tert-butyl N-(4-hydroxycyclohexyl)carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(O)CC1.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.NC1CCC(O)CC1 |
| InChI | InChI=1S/C11H21NO3.C10H18O5.C6H13NO/c1-11(2,3)15-10(14)12-8-4-6-9(13)7-5-8;1-9(2,3)14-7(11)13-8(12)15-10(4,5)6;7-5-1-3-6(8)4-2-5/h8-9,13H,4-7H2,1-3H3,(H,12,14);1-6H3;5-6,8H,1-4,7H2 |
| InChIKey | SNAGFKXLHBSVLL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 166.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|