C9H17N3O2 — CID 60700103
3-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]propanamide (PubChem CID 60700103) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]propanamide.
| Compound Name | 3-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]propanamide |
|---|---|
| PubChem CID | 60700103 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 3-[[2-(cyclopropylamino)-2-oxoethyl]-methylamino]propanamide |
| SMILES | CN(CCC(N)=O)CC(=O)NC1CC1 |
| InChI | InChI=1S/C9H17N3O2/c1-12(5-4-8(10)13)6-9(14)11-7-2-3-7/h7H,2-6H2,1H3,(H2,10,13)(H,11,14) |
| InChIKey | KQHVCEHKPQMSEN-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |