C10H20IN3O — CID 88963295
2-(dimethylamino)-N-[4-(iodoamino)cyclohexyl]acetamide (PubChem CID 88963295) has the molecular formula C10H20IN3O and a molecular weight of 325.19 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[4-(iodoamino)cyclohexyl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[4-(iodoamino)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 88963295 |
| Molecular Formula | C10H20IN3O |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-(dimethylamino)-N-[4-(iodoamino)cyclohexyl]acetamide |
| SMILES | CN(C)CC(=O)NC1CCC(NI)CC1 |
| InChI | InChI=1S/C10H20IN3O/c1-14(2)7-10(15)12-8-3-5-9(13-11)6-4-8/h8-9,13H,3-7H2,1-2H3,(H,12,15) |
| InChIKey | HJCMIAOFIXFNNG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|