C6H7F6NO2 — CID 103770162
N-(3,3-difluoro-2-hydroxypropyl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103770162) has the molecular formula C6H7F6NO2 and a molecular weight of 239.12 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103770162 |
| Molecular Formula | C6H7F6NO2 |
| Molecular Weight | 239.12 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(NCC(O)C(F)F)C(F)(F)C(F)F |
| InChI | InChI=1S/C6H7F6NO2/c7-3(8)2(14)1-13-5(15)6(11,12)4(9)10/h2-4,14H,1H2,(H,13,15) |
| InChIKey | BDQNZTSILCBJTL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.12 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|