C7H10F3NO5 — CID 154291457
2,2,2-trifluoro-N-[(2R,3S,4R)-2,3,4-trihydroxy-5-oxopentyl]acetamide (PubChem CID 154291457) has the molecular formula C7H10F3NO5 and a molecular weight of 245.15 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2R,3S,4R)-2,3,4-trihydroxy-5-oxopentyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2R,3S,4R)-2,3,4-trihydroxy-5-oxopentyl]acetamide |
|---|---|
| PubChem CID | 154291457 |
| Molecular Formula | C7H10F3NO5 |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2R,3S,4R)-2,3,4-trihydroxy-5-oxopentyl]acetamide |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H10F3NO5/c8-7(9,10)6(16)11-1-3(13)5(15)4(14)2-12/h2-5,13-15H,1H2,(H,11,16)/t3-,4+,5+/m1/s1 |
| InChIKey | LWCKIBFLBDJEIM-WISUUJSJSA-N |
| XLogP | -2.05 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|