C8H13F3O8 — CID 157246185
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;2,2,2-trifluoroacetic acid (PubChem CID 157246185) has the molecular formula C8H13F3O8 and a molecular weight of 294.18 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 157246185 |
| Molecular Formula | C8H13F3O8 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6.C2HF3O2/c7-1-3(9)5(11)6(12)4(10)2-8;3-2(4,5)1(6)7/h1,3-6,8-12H,2H2;(H,6,7)/t3-,4+,5+,6+;/m0./s1 |
| InChIKey | AVUIIBVUQKEXNZ-BTVCFUMJSA-N |
| XLogP | -2.75 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|