C10H11F3N2O2 — CID 107335113
N-[2-(4-aminophenyl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide (PubChem CID 107335113) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(4-aminophenyl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 107335113 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | N-[2-(4-aminophenyl)-2-hydroxyethyl]-2,2,2-trifluoroacetamide |
| SMILES | Nc1ccc(C(O)CNC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3N2O2/c11-10(12,13)9(17)15-5-8(16)6-1-3-7(14)4-2-6/h1-4,8,16H,5,14H2,(H,15,17) |
| InChIKey | MYNMGLNLNWDYIH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|