methyl N-(3,3-difluoro-2-hydroxypropyl)carbamate

C5H9F2NO3 — CID 103769673

IUPACmethyl N-(3,3-difluoro-2-hydroxypropyl)carbamate
SMILESCOC(=O)NCC(O)C(F)F
InChIInChI=1S/C5H9F2NO3/c1-11-5(10)8-2-3(9)4(6)7/h3-4,9H,2H2,1H3,(H,8,10)
InChIKeyDWXMJUZPAYYOMC-UHFFFAOYSA-N
MW169.13 g/mol
LogP-0.03
Rot. Bonds3

About methyl N-(3,3-difluoro-2-hydroxypropyl)carbamate

methyl N-(3,3-difluoro-2-hydroxypropyl)carbamate (PubChem CID 103769673) has the molecular formula C5H9F2NO3 and a molecular weight of 169.13 g/mol. Its IUPAC name is methyl N-(3,3-difluoro-2-hydroxypropyl)carbamate.

Molecular Properties

Compound Namemethyl N-(3,3-difluoro-2-hydroxypropyl)carbamate
PubChem CID103769673
Molecular FormulaC5H9F2NO3
Molecular Weight169.13 g/mol
Exact Mass169.06
IUPAC Namemethyl N-(3,3-difluoro-2-hydroxypropyl)carbamate
SMILESCOC(=O)NCC(O)C(F)F
InChIInChI=1S/C5H9F2NO3/c1-11-5(10)8-2-3(9)4(6)7/h3-4,9H,2H2,1H3,(H,8,10)
InChIKeyDWXMJUZPAYYOMC-UHFFFAOYSA-N
XLogP-0.03
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.13
LogP ≤ 5-0.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze methyl N-(3,3-difluoro-2-hydroxypropyl)carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-(3,3-difluoro-2-hydroxypropyl)carbamate?
The IUPAC name of methyl N-(3,3-difluoro-2-hydroxypropyl)carbamate (CID 103769673) is methyl N-(3,3-difluoro-2-hydroxypropyl)carbamate.
What is the SMILES notation for methyl N-(3,3-difluoro-2-hydroxypropyl)carbamate?
The canonical SMILES for methyl N-(3,3-difluoro-2-hydroxypropyl)carbamate is COC(=O)NCC(O)C(F)F.
What is the InChIKey of methyl N-(3,3-difluoro-2-hydroxypropyl)carbamate?
The InChIKey is DWXMJUZPAYYOMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F2NO3/c1-11-5(10)8-2-3(9)4(6)7/h3-4,9H,2H2,1H3,(H,8,10).
What are the key properties of methyl N-(3,3-difluoro-2-hydroxypropyl)carbamate?
methyl N-(3,3-difluoro-2-hydroxypropyl)carbamate has a molecular weight of 169.13 g/mol, XLogP of -0.03, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(3,3-difluoro-2-hydroxypropyl)carbamate is sourced from PubChem (CID 103769673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).