C7H14N2O4 — CID 23527594
methyl N-(3-acetamido-2-hydroxypropyl)carbamate (PubChem CID 23527594) has the molecular formula C7H14N2O4 and a molecular weight of 190.20 g/mol. Its IUPAC name is methyl N-(3-acetamido-2-hydroxypropyl)carbamate.
| Compound Name | methyl N-(3-acetamido-2-hydroxypropyl)carbamate |
|---|---|
| PubChem CID | 23527594 |
| Molecular Formula | C7H14N2O4 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | methyl N-(3-acetamido-2-hydroxypropyl)carbamate |
| SMILES | COC(=O)NCC(O)CNC(C)=O |
| InChI | InChI=1S/C7H14N2O4/c1-5(10)8-3-6(11)4-9-7(12)13-2/h6,11H,3-4H2,1-2H3,(H,8,10)(H,9,12) |
| InChIKey | NBWRGUCQYYVEHZ-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |