C17H38N2O5 — CID 162245001
methane;methyl N-(3-methyl-2-oxobutyl)carbamate;N-(3-methyl-2-oxobutyl)acetamide (PubChem CID 162245001) has the molecular formula C17H38N2O5 and a molecular weight of 350.50 g/mol. Its IUPAC name is methane;methyl N-(3-methyl-2-oxobutyl)carbamate;N-(3-methyl-2-oxobutyl)acetamide.
| Compound Name | methane;methyl N-(3-methyl-2-oxobutyl)carbamate;N-(3-methyl-2-oxobutyl)acetamide |
|---|---|
| PubChem CID | 162245001 |
| Molecular Formula | C17H38N2O5 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | methane;methyl N-(3-methyl-2-oxobutyl)carbamate;N-(3-methyl-2-oxobutyl)acetamide |
| SMILES | C.C.C.CC(=O)NCC(=O)C(C)C.COC(=O)NCC(=O)C(C)C |
| InChI | InChI=1S/C7H13NO3.C7H13NO2.3CH4/c1-5(2)6(9)4-8-7(10)11-3;1-5(2)7(10)4-8-6(3)9;;;/h5H,4H2,1-3H3,(H,8,10);5H,4H2,1-3H3,(H,8,9);3*1H4 |
| InChIKey | ZXFFKEDQLDFMIW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |