C18H30N2O4 — CID 59440307
1-N,4-N-bis(3-methyl-2-oxobutyl)cyclohexane-1,4-dicarboxamide (PubChem CID 59440307) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-N,4-N-bis(3-methyl-2-oxobutyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(3-methyl-2-oxobutyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 59440307 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 1-N,4-N-bis(3-methyl-2-oxobutyl)cyclohexane-1,4-dicarboxamide |
| SMILES | CC(C)C(=O)CNC(=O)C1CCC(C(=O)NCC(=O)C(C)C)CC1 |
| InChI | InChI=1S/C18H30N2O4/c1-11(2)15(21)9-19-17(23)13-5-7-14(8-6-13)18(24)20-10-16(22)12(3)4/h11-14H,5-10H2,1-4H3,(H,19,23)(H,20,24) |
| InChIKey | KCDHRNQHJVFKKH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |