C23H46N2O5 — CID 177357306
ethane;4-[3-(2-ethoxyethoxy)propanoylamino]-N-(3-methyl-2-oxobutyl)cyclohexane-1-carboxamide (PubChem CID 177357306) has the molecular formula C23H46N2O5 and a molecular weight of 430.63 g/mol. Its IUPAC name is ethane;4-[3-(2-ethoxyethoxy)propanoylamino]-N-(3-methyl-2-oxobutyl)cyclohexane-1-carboxamide.
| Compound Name | ethane;4-[3-(2-ethoxyethoxy)propanoylamino]-N-(3-methyl-2-oxobutyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 177357306 |
| Molecular Formula | C23H46N2O5 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | ethane;4-[3-(2-ethoxyethoxy)propanoylamino]-N-(3-methyl-2-oxobutyl)cyclohexane-1-carboxamide |
| SMILES | CC.CC.CCOCCOCCC(=O)NC1CCC(C(=O)NCC(=O)C(C)C)CC1 |
| InChI | InChI=1S/C19H34N2O5.2C2H6/c1-4-25-11-12-26-10-9-18(23)21-16-7-5-15(6-8-16)19(24)20-13-17(22)14(2)3;2*1-2/h14-16H,4-13H2,1-3H3,(H,20,24)(H,21,23);2*1-2H3 |
| InChIKey | RNZFEQBPGQSQIO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|