C19H36N2O5 — CID 169159604
ethane;4-[3-(2-methoxyethoxy)propanoylamino]-N-(2-oxobutyl)cyclohexane-1-carboxamide (PubChem CID 169159604) has the molecular formula C19H36N2O5 and a molecular weight of 372.51 g/mol. Its IUPAC name is ethane;4-[3-(2-methoxyethoxy)propanoylamino]-N-(2-oxobutyl)cyclohexane-1-carboxamide.
| Compound Name | ethane;4-[3-(2-methoxyethoxy)propanoylamino]-N-(2-oxobutyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 169159604 |
| Molecular Formula | C19H36N2O5 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | ethane;4-[3-(2-methoxyethoxy)propanoylamino]-N-(2-oxobutyl)cyclohexane-1-carboxamide |
| SMILES | CC.CCC(=O)CNC(=O)C1CCC(NC(=O)CCOCCOC)CC1 |
| InChI | InChI=1S/C17H30N2O5.C2H6/c1-3-15(20)12-18-17(22)13-4-6-14(7-5-13)19-16(21)8-9-24-11-10-23-2;1-2/h13-14H,3-12H2,1-2H3,(H,18,22)(H,19,21);1-2H3 |
| InChIKey | OPHCXJQYRFYSBY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|