C18H32N2O5 — CID 169158474
4-(3-ethoxypropanoylamino)-N-[2-(2-oxobutoxy)ethyl]cyclohexane-1-carboxamide (PubChem CID 169158474) has the molecular formula C18H32N2O5 and a molecular weight of 356.46 g/mol. Its IUPAC name is 4-(3-ethoxypropanoylamino)-N-[2-(2-oxobutoxy)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 4-(3-ethoxypropanoylamino)-N-[2-(2-oxobutoxy)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 169158474 |
| Molecular Formula | C18H32N2O5 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 4-(3-ethoxypropanoylamino)-N-[2-(2-oxobutoxy)ethyl]cyclohexane-1-carboxamide |
| SMILES | CCOCCC(=O)NC1CCC(C(=O)NCCOCC(=O)CC)CC1 |
| InChI | InChI=1S/C18H32N2O5/c1-3-16(21)13-25-12-10-19-18(23)14-5-7-15(8-6-14)20-17(22)9-11-24-4-2/h14-15H,3-13H2,1-2H3,(H,19,23)(H,20,22) |
| InChIKey | WZELBOBBCCTDET-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|