C19H38N2O5 — CID 169159539
molecular hydrogen;3-[2-[2-(propanoylamino)ethoxy]ethoxy]-N-(4-propanoylcyclohexyl)propanamide (PubChem CID 169159539) has the molecular formula C19H38N2O5 and a molecular weight of 374.52 g/mol. Its IUPAC name is molecular hydrogen;3-[2-[2-(propanoylamino)ethoxy]ethoxy]-N-(4-propanoylcyclohexyl)propanamide.
| Compound Name | molecular hydrogen;3-[2-[2-(propanoylamino)ethoxy]ethoxy]-N-(4-propanoylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 169159539 |
| Molecular Formula | C19H38N2O5 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | molecular hydrogen;3-[2-[2-(propanoylamino)ethoxy]ethoxy]-N-(4-propanoylcyclohexyl)propanamide |
| SMILES | CCC(=O)NCCOCCOCCC(=O)NC1CCC(C(=O)CC)CC1.[H][H].[H][H] |
| InChI | InChI=1S/C19H34N2O5.2H2/c1-3-17(22)15-5-7-16(8-6-15)21-19(24)9-11-25-13-14-26-12-10-20-18(23)4-2;;/h15-16H,3-14H2,1-2H3,(H,20,23)(H,21,24);2*1H |
| InChIKey | NDIPTJMRKHYLFQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|