C18H38N2O5 — CID 169158637
1-cyclobutylpropan-1-one;molecular hydrogen;3-[2-(3-propan-2-yloxypropanoylamino)ethoxy]propanamide (PubChem CID 169158637) has the molecular formula C18H38N2O5 and a molecular weight of 362.51 g/mol. Its IUPAC name is 1-cyclobutylpropan-1-one;molecular hydrogen;3-[2-(3-propan-2-yloxypropanoylamino)ethoxy]propanamide.
| Compound Name | 1-cyclobutylpropan-1-one;molecular hydrogen;3-[2-(3-propan-2-yloxypropanoylamino)ethoxy]propanamide |
|---|---|
| PubChem CID | 169158637 |
| Molecular Formula | C18H38N2O5 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 1-cyclobutylpropan-1-one;molecular hydrogen;3-[2-(3-propan-2-yloxypropanoylamino)ethoxy]propanamide |
| SMILES | CC(C)OCCC(=O)NCCOCCC(N)=O.CCC(=O)C1CCC1.[H][H].[H][H] |
| InChI | InChI=1S/C11H22N2O4.C7H12O.2H2/c1-9(2)17-7-4-11(15)13-5-8-16-6-3-10(12)14;1-2-7(8)6-4-3-5-6;;/h9H,3-8H2,1-2H3,(H2,12,14)(H,13,15);6H,2-5H2,1H3;2*1H |
| InChIKey | IKHJHXBTMKCZCQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|