C19H39NO5 — CID 169158833
1-cyclohexylpropan-1-one;ethane;3-[2-(2-methoxyethoxy)ethoxy]propanamide (PubChem CID 169158833) has the molecular formula C19H39NO5 and a molecular weight of 361.52 g/mol. Its IUPAC name is 1-cyclohexylpropan-1-one;ethane;3-[2-(2-methoxyethoxy)ethoxy]propanamide.
| Compound Name | 1-cyclohexylpropan-1-one;ethane;3-[2-(2-methoxyethoxy)ethoxy]propanamide |
|---|---|
| PubChem CID | 169158833 |
| Molecular Formula | C19H39NO5 |
| Molecular Weight | 361.52 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | 1-cyclohexylpropan-1-one;ethane;3-[2-(2-methoxyethoxy)ethoxy]propanamide |
| SMILES | CC.CCC(=O)C1CCCCC1.COCCOCCOCCC(N)=O |
| InChI | InChI=1S/C9H16O.C8H17NO4.C2H6/c1-2-9(10)8-6-4-3-5-7-8;1-11-4-5-13-7-6-12-3-2-8(9)10;1-2/h8H,2-7H2,1H3;2-7H2,1H3,(H2,9,10);1-2H3 |
| InChIKey | XBQJOZAPECQACL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|