About 1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide
1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide (PubChem CID 169159187) has the molecular formula C20H41NO5
and a molecular weight of 375.55 g/mol. Its IUPAC name is 1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide.
Molecular Properties
| Compound Name | 1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide |
| PubChem CID | 169159187 |
| Molecular Formula | C20H41NO5 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.30 |
| IUPAC Name | 1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide |
| SMILES | CC(C)C(=O)C1CCCCC1.CC(C)OCCOCCOCCC(N)=O.[H][H] |
| InChI | InChI=1S/C10H21NO4.C10H18O.H2/c1-9(2)15-8-7-14-6-5-13-4-3-10(11)12;1-8(2)10(11)9-6-4-3-5-7-9;/h9H,3-8H2,1-2H3,(H2,11,12);8-9H,3-7H2,1-2H3;1H |
| InChIKey | ANZHJBQDQSWXAL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide?
The IUPAC name of 1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide (CID 169159187) is 1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide.
What is the SMILES notation for 1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide?
The canonical SMILES for 1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide is CC(C)C(=O)C1CCCCC1.CC(C)OCCOCCOCCC(N)=O.[H][H].
What is the InChIKey of 1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide?
The InChIKey is ANZHJBQDQSWXAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO4.C10H18O.H2/c1-9(2)15-8-7-14-6-5-13-4-3-10(11)12;1-8(2)10(11)9-6-4-3-5-7-9;/h9H,3-8H2,1-2H3,(H2,11,12);8-9H,3-7H2,1-2H3;1H.
What are the key properties of 1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide?
1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide has a molecular weight of 375.55 g/mol, XLogP of 3.36, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide is sourced from PubChem (CID 169159187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).