C20H41NO5 — CID 169159187
1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide (PubChem CID 169159187) has the molecular formula C20H41NO5 and a molecular weight of 375.55 g/mol. Its IUPAC name is 1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide.
| Compound Name | 1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide |
|---|---|
| PubChem CID | 169159187 |
| Molecular Formula | C20H41NO5 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.30 |
| IUPAC Name | 1-cyclohexyl-2-methylpropan-1-one;molecular hydrogen;3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanamide |
| SMILES | CC(C)C(=O)C1CCCCC1.CC(C)OCCOCCOCCC(N)=O.[H][H] |
| InChI | InChI=1S/C10H21NO4.C10H18O.H2/c1-9(2)15-8-7-14-6-5-13-4-3-10(11)12;1-8(2)10(11)9-6-4-3-5-7-9;/h9H,3-8H2,1-2H3,(H2,11,12);8-9H,3-7H2,1-2H3;1H |
| InChIKey | ANZHJBQDQSWXAL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|