C25H47NO4 — CID 169158808
1-cyclohexyl-2-methylpropan-1-one;4-[[4-(propan-2-yloxymethyl)cyclohexyl]methoxy]butanamide (PubChem CID 169158808) has the molecular formula C25H47NO4 and a molecular weight of 425.65 g/mol. Its IUPAC name is 1-cyclohexyl-2-methylpropan-1-one;4-[[4-(propan-2-yloxymethyl)cyclohexyl]methoxy]butanamide.
| Compound Name | 1-cyclohexyl-2-methylpropan-1-one;4-[[4-(propan-2-yloxymethyl)cyclohexyl]methoxy]butanamide |
|---|---|
| PubChem CID | 169158808 |
| Molecular Formula | C25H47NO4 |
| Molecular Weight | 425.65 g/mol |
| Exact Mass | 425.35 |
| IUPAC Name | 1-cyclohexyl-2-methylpropan-1-one;4-[[4-(propan-2-yloxymethyl)cyclohexyl]methoxy]butanamide |
| SMILES | CC(C)C(=O)C1CCCCC1.CC(C)OCC1CCC(COCCCC(N)=O)CC1 |
| InChI | InChI=1S/C15H29NO3.C10H18O/c1-12(2)19-11-14-7-5-13(6-8-14)10-18-9-3-4-15(16)17;1-8(2)10(11)9-6-4-3-5-7-9/h12-14H,3-11H2,1-2H3,(H2,16,17);8-9H,3-7H2,1-2H3 |
| InChIKey | CXHPDMBDQVLQBM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|