C19H34N2O5 — CID 169158949
N-[2-oxo-2-[(4-propanoylcyclohexyl)amino]ethyl]-3-(2-propan-2-yloxyethoxy)propanamide (PubChem CID 169158949) has the molecular formula C19H34N2O5 and a molecular weight of 370.49 g/mol. Its IUPAC name is N-[2-oxo-2-[(4-propanoylcyclohexyl)amino]ethyl]-3-(2-propan-2-yloxyethoxy)propanamide.
| Compound Name | N-[2-oxo-2-[(4-propanoylcyclohexyl)amino]ethyl]-3-(2-propan-2-yloxyethoxy)propanamide |
|---|---|
| PubChem CID | 169158949 |
| Molecular Formula | C19H34N2O5 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | N-[2-oxo-2-[(4-propanoylcyclohexyl)amino]ethyl]-3-(2-propan-2-yloxyethoxy)propanamide |
| SMILES | CCC(=O)C1CCC(NC(=O)CNC(=O)CCOCCOC(C)C)CC1 |
| InChI | InChI=1S/C19H34N2O5/c1-4-17(22)15-5-7-16(8-6-15)21-19(24)13-20-18(23)9-10-25-11-12-26-14(2)3/h14-16H,4-13H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | CABBQHXYONNGQB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|