C23H44N2O5 — CID 177357226
ethane;2-methyl-N-[2-[2-[3-[[4-(2-methylpropanoyl)cyclohexyl]amino]-3-oxopropoxy]ethoxy]ethyl]propanamide (PubChem CID 177357226) has the molecular formula C23H44N2O5 and a molecular weight of 428.61 g/mol. Its IUPAC name is ethane;2-methyl-N-[2-[2-[3-[[4-(2-methylpropanoyl)cyclohexyl]amino]-3-oxopropoxy]ethoxy]ethyl]propanamide.
| Compound Name | ethane;2-methyl-N-[2-[2-[3-[[4-(2-methylpropanoyl)cyclohexyl]amino]-3-oxopropoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 177357226 |
| Molecular Formula | C23H44N2O5 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | ethane;2-methyl-N-[2-[2-[3-[[4-(2-methylpropanoyl)cyclohexyl]amino]-3-oxopropoxy]ethoxy]ethyl]propanamide |
| SMILES | CC.CC(C)C(=O)NCCOCCOCCC(=O)NC1CCC(C(=O)C(C)C)CC1 |
| InChI | InChI=1S/C21H38N2O5.C2H6/c1-15(2)20(25)17-5-7-18(8-6-17)23-19(24)9-11-27-13-14-28-12-10-22-21(26)16(3)4;1-2/h15-18H,5-14H2,1-4H3,(H,22,26)(H,23,24);1-2H3 |
| InChIKey | KIQFFIPZFSYQLF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|