C21H41NO4 — CID 167464298
N-[4-(2-methylpropanoyl)cyclohexyl]-4-[3-(2-methylpropoxy)propoxy]butanamide;molecular hydrogen (PubChem CID 167464298) has the molecular formula C21H41NO4 and a molecular weight of 371.56 g/mol. Its IUPAC name is N-[4-(2-methylpropanoyl)cyclohexyl]-4-[3-(2-methylpropoxy)propoxy]butanamide;molecular hydrogen.
| Compound Name | N-[4-(2-methylpropanoyl)cyclohexyl]-4-[3-(2-methylpropoxy)propoxy]butanamide;molecular hydrogen |
|---|---|
| PubChem CID | 167464298 |
| Molecular Formula | C21H41NO4 |
| Molecular Weight | 371.56 g/mol |
| Exact Mass | 371.30 |
| IUPAC Name | N-[4-(2-methylpropanoyl)cyclohexyl]-4-[3-(2-methylpropoxy)propoxy]butanamide;molecular hydrogen |
| SMILES | CC(C)COCCCOCCCC(=O)NC1CCC(C(=O)C(C)C)CC1.[H][H] |
| InChI | InChI=1S/C21H39NO4.H2/c1-16(2)15-26-14-6-13-25-12-5-7-20(23)22-19-10-8-18(9-11-19)21(24)17(3)4;/h16-19H,5-15H2,1-4H3,(H,22,23);1H |
| InChIKey | SKXAQZNCVNYNAL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|