C21H41NO4 — CID 178082793
N-(4-acetylcyclohexyl)-4-cyclohexyloxybutanamide;molecular hydrogen;propan-2-ol (PubChem CID 178082793) has the molecular formula C21H41NO4 and a molecular weight of 371.56 g/mol. Its IUPAC name is N-(4-acetylcyclohexyl)-4-cyclohexyloxybutanamide;molecular hydrogen;propan-2-ol.
| Compound Name | N-(4-acetylcyclohexyl)-4-cyclohexyloxybutanamide;molecular hydrogen;propan-2-ol |
|---|---|
| PubChem CID | 178082793 |
| Molecular Formula | C21H41NO4 |
| Molecular Weight | 371.56 g/mol |
| Exact Mass | 371.30 |
| IUPAC Name | N-(4-acetylcyclohexyl)-4-cyclohexyloxybutanamide;molecular hydrogen;propan-2-ol |
| SMILES | CC(=O)C1CCC(NC(=O)CCCOC2CCCCC2)CC1.CC(C)O.[H][H] |
| InChI | InChI=1S/C18H31NO3.C3H8O.H2/c1-14(20)15-9-11-16(12-10-15)19-18(21)8-5-13-22-17-6-3-2-4-7-17;1-3(2)4;/h15-17H,2-13H2,1H3,(H,19,21);3-4H,1-2H3;1H |
| InChIKey | MUCWVNVBWZTKRS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|