C18H31NO3 — CID 177358183
N-(4-acetylcyclohexyl)-4-cyclohexyloxybutanamide (PubChem CID 177358183) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is N-(4-acetylcyclohexyl)-4-cyclohexyloxybutanamide.
| Compound Name | N-(4-acetylcyclohexyl)-4-cyclohexyloxybutanamide |
|---|---|
| PubChem CID | 177358183 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | N-(4-acetylcyclohexyl)-4-cyclohexyloxybutanamide |
| SMILES | CC(=O)C1CCC(NC(=O)CCCOC2CCCCC2)CC1 |
| InChI | InChI=1S/C18H31NO3/c1-14(20)15-9-11-16(12-10-15)19-18(21)8-5-13-22-17-6-3-2-4-7-17/h15-17H,2-13H2,1H3,(H,19,21) |
| InChIKey | SCXCQTOTFZVECN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|