C20H37NO4 — CID 169158273
molecular hydrogen;N-(3-propanoylcyclobutyl)-4-(4-propan-2-yloxycyclohexyl)oxybutanamide (PubChem CID 169158273) has the molecular formula C20H37NO4 and a molecular weight of 355.52 g/mol. Its IUPAC name is molecular hydrogen;N-(3-propanoylcyclobutyl)-4-(4-propan-2-yloxycyclohexyl)oxybutanamide.
| Compound Name | molecular hydrogen;N-(3-propanoylcyclobutyl)-4-(4-propan-2-yloxycyclohexyl)oxybutanamide |
|---|---|
| PubChem CID | 169158273 |
| Molecular Formula | C20H37NO4 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | molecular hydrogen;N-(3-propanoylcyclobutyl)-4-(4-propan-2-yloxycyclohexyl)oxybutanamide |
| SMILES | CCC(=O)C1CC(NC(=O)CCCOC2CCC(OC(C)C)CC2)C1.[H][H] |
| InChI | InChI=1S/C20H35NO4.H2/c1-4-19(22)15-12-16(13-15)21-20(23)6-5-11-24-17-7-9-18(10-8-17)25-14(2)3;/h14-18H,4-13H2,1-3H3,(H,21,23);1H |
| InChIKey | IQTSMMQBBRZYKP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|