C20H35NO4 — CID 167464210
3-(4-ethoxycyclohexyl)oxy-N-(4-propanoylcyclohexyl)propanamide (PubChem CID 167464210) has the molecular formula C20H35NO4 and a molecular weight of 353.50 g/mol. Its IUPAC name is 3-(4-ethoxycyclohexyl)oxy-N-(4-propanoylcyclohexyl)propanamide.
| Compound Name | 3-(4-ethoxycyclohexyl)oxy-N-(4-propanoylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 167464210 |
| Molecular Formula | C20H35NO4 |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 3-(4-ethoxycyclohexyl)oxy-N-(4-propanoylcyclohexyl)propanamide |
| SMILES | CCOC1CCC(OCCC(=O)NC2CCC(C(=O)CC)CC2)CC1 |
| InChI | InChI=1S/C20H35NO4/c1-3-19(22)15-5-7-16(8-6-15)21-20(23)13-14-25-18-11-9-17(10-12-18)24-4-2/h15-18H,3-14H2,1-2H3,(H,21,23) |
| InChIKey | QBFLKQNHIKOXBX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |