C23H45NO4 — CID 178082611
N-(4-acetylcyclohexyl)-4-(4-propan-2-yloxycyclohexyl)oxybutanamide;ethane;molecular hydrogen (PubChem CID 178082611) has the molecular formula C23H45NO4 and a molecular weight of 399.62 g/mol. Its IUPAC name is N-(4-acetylcyclohexyl)-4-(4-propan-2-yloxycyclohexyl)oxybutanamide;ethane;molecular hydrogen.
| Compound Name | N-(4-acetylcyclohexyl)-4-(4-propan-2-yloxycyclohexyl)oxybutanamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 178082611 |
| Molecular Formula | C23H45NO4 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.33 |
| IUPAC Name | N-(4-acetylcyclohexyl)-4-(4-propan-2-yloxycyclohexyl)oxybutanamide;ethane;molecular hydrogen |
| SMILES | CC.CC(=O)C1CCC(NC(=O)CCCOC2CCC(OC(C)C)CC2)CC1.[H][H] |
| InChI | InChI=1S/C21H37NO4.C2H6.H2/c1-15(2)26-20-12-10-19(11-13-20)25-14-4-5-21(24)22-18-8-6-17(7-9-18)16(3)23;1-2;/h15,17-20H,4-14H2,1-3H3,(H,22,24);1-2H3;1H |
| InChIKey | FQPMICXYNAYTPV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|