C20H40N2O5 — CID 169159088
3-ethoxy-N-[2-[3-[[4-(2-methylpropanoyl)cyclohexyl]amino]-3-oxopropoxy]ethyl]propanamide;molecular hydrogen (PubChem CID 169159088) has the molecular formula C20H40N2O5 and a molecular weight of 388.55 g/mol. Its IUPAC name is 3-ethoxy-N-[2-[3-[[4-(2-methylpropanoyl)cyclohexyl]amino]-3-oxopropoxy]ethyl]propanamide;molecular hydrogen.
| Compound Name | 3-ethoxy-N-[2-[3-[[4-(2-methylpropanoyl)cyclohexyl]amino]-3-oxopropoxy]ethyl]propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 169159088 |
| Molecular Formula | C20H40N2O5 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | 3-ethoxy-N-[2-[3-[[4-(2-methylpropanoyl)cyclohexyl]amino]-3-oxopropoxy]ethyl]propanamide;molecular hydrogen |
| SMILES | CCOCCC(=O)NCCOCCC(=O)NC1CCC(C(=O)C(C)C)CC1.[H][H].[H][H] |
| InChI | InChI=1S/C20H36N2O5.2H2/c1-4-26-12-9-18(23)21-11-14-27-13-10-19(24)22-17-7-5-16(6-8-17)20(25)15(2)3;;/h15-17H,4-14H2,1-3H3,(H,21,23)(H,22,24);2*1H |
| InChIKey | WDLMVYQJPBAXMO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|