C24H43N3O4 — CID 167464295
N-[4-(2-methylbutylamino)-4-oxobutyl]-N'-[4-(2-methylpropanoyl)cyclohexyl]pentanediamide (PubChem CID 167464295) has the molecular formula C24H43N3O4 and a molecular weight of 437.63 g/mol. Its IUPAC name is N-[4-(2-methylbutylamino)-4-oxobutyl]-N'-[4-(2-methylpropanoyl)cyclohexyl]pentanediamide.
| Compound Name | N-[4-(2-methylbutylamino)-4-oxobutyl]-N'-[4-(2-methylpropanoyl)cyclohexyl]pentanediamide |
|---|---|
| PubChem CID | 167464295 |
| Molecular Formula | C24H43N3O4 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.33 |
| IUPAC Name | N-[4-(2-methylbutylamino)-4-oxobutyl]-N'-[4-(2-methylpropanoyl)cyclohexyl]pentanediamide |
| SMILES | CCC(C)CNC(=O)CCCNC(=O)CCCC(=O)NC1CCC(C(=O)C(C)C)CC1 |
| InChI | InChI=1S/C24H43N3O4/c1-5-18(4)16-26-22(29)10-7-15-25-21(28)8-6-9-23(30)27-20-13-11-19(12-14-20)24(31)17(2)3/h17-20H,5-16H2,1-4H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | IZJUBNMEBQSJFK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|