About 1-cyclohexyl-2-methylpropan-1-one;N-methyl-N'-(3-methylpentyl)pentanediamide;molecular hydrogen
1-cyclohexyl-2-methylpropan-1-one;N-methyl-N'-(3-methylpentyl)pentanediamide;molecular hydrogen (PubChem CID 177358052) has the molecular formula C22H46N2O3
and a molecular weight of 386.62 g/mol. Its IUPAC name is 1-cyclohexyl-2-methylpropan-1-one;N-methyl-N'-(3-methylpentyl)pentanediamide;molecular hydrogen.
Molecular Properties
| Compound Name | 1-cyclohexyl-2-methylpropan-1-one;N-methyl-N'-(3-methylpentyl)pentanediamide;molecular hydrogen |
| PubChem CID | 177358052 |
| Molecular Formula | C22H46N2O3 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.35 |
| IUPAC Name | 1-cyclohexyl-2-methylpropan-1-one;N-methyl-N'-(3-methylpentyl)pentanediamide;molecular hydrogen |
| SMILES | CC(C)C(=O)C1CCCCC1.CCC(C)CCNC(=O)CCCC(=O)NC.[H][H].[H][H] |
| InChI | InChI=1S/C12H24N2O2.C10H18O.2H2/c1-4-10(2)8-9-14-12(16)7-5-6-11(15)13-3;1-8(2)10(11)9-6-4-3-5-7-9;;/h10H,4-9H2,1-3H3,(H,13,15)(H,14,16);8-9H,3-7H2,1-2H3;2*1H |
| InChIKey | BXNUVLPOOXFLHL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexyl-2-methylpropan-1-one;N-methyl-N'-(3-methylpentyl)pentanediamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2-methylpropan-1-one;N-methyl-N'-(3-methylpentyl)pentanediamide;molecular hydrogen?
The IUPAC name of 1-cyclohexyl-2-methylpropan-1-one;N-methyl-N'-(3-methylpentyl)pentanediamide;molecular hydrogen (CID 177358052) is 1-cyclohexyl-2-methylpropan-1-one;N-methyl-N'-(3-methylpentyl)pentanediamide;molecular hydrogen.
What is the SMILES notation for 1-cyclohexyl-2-methylpropan-1-one;N-methyl-N'-(3-methylpentyl)pentanediamide;molecular hydrogen?
The canonical SMILES for 1-cyclohexyl-2-methylpropan-1-one;N-methyl-N'-(3-methylpentyl)pentanediamide;molecular hydrogen is CC(C)C(=O)C1CCCCC1.CCC(C)CCNC(=O)CCCC(=O)NC.[H][H].[H][H].
What is the InChIKey of 1-cyclohexyl-2-methylpropan-1-one;N-methyl-N'-(3-methylpentyl)pentanediamide;molecular hydrogen?
The InChIKey is BXNUVLPOOXFLHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2.C10H18O.2H2/c1-4-10(2)8-9-14-12(16)7-5-6-11(15)13-3;1-8(2)10(11)9-6-4-3-5-7-9;;/h10H,4-9H2,1-3H3,(H,13,15)(H,14,16);8-9H,3-7H2,1-2H3;2*1H.
What are the key properties of 1-cyclohexyl-2-methylpropan-1-one;N-methyl-N'-(3-methylpentyl)pentanediamide;molecular hydrogen?
1-cyclohexyl-2-methylpropan-1-one;N-methyl-N'-(3-methylpentyl)pentanediamide;molecular hydrogen has a molecular weight of 386.62 g/mol, XLogP of 4.74, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2-methylpropan-1-one;N-methyl-N'-(3-methylpentyl)pentanediamide;molecular hydrogen is sourced from PubChem (CID 177358052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).