C20H36N2O3 — CID 178126271
N-butyl-N'-[[4-(2-methylpropanoyl)cyclohexyl]methyl]pentanediamide (PubChem CID 178126271) has the molecular formula C20H36N2O3 and a molecular weight of 352.52 g/mol. Its IUPAC name is N-butyl-N'-[[4-(2-methylpropanoyl)cyclohexyl]methyl]pentanediamide.
| Compound Name | N-butyl-N'-[[4-(2-methylpropanoyl)cyclohexyl]methyl]pentanediamide |
|---|---|
| PubChem CID | 178126271 |
| Molecular Formula | C20H36N2O3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | N-butyl-N'-[[4-(2-methylpropanoyl)cyclohexyl]methyl]pentanediamide |
| SMILES | CCCCNC(=O)CCCC(=O)NCC1CCC(C(=O)C(C)C)CC1 |
| InChI | InChI=1S/C20H36N2O3/c1-4-5-13-21-18(23)7-6-8-19(24)22-14-16-9-11-17(12-10-16)20(25)15(2)3/h15-17H,4-14H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | FPHDVFDKWBQESS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|