C13H23N3O4 — CID 81070939
4-[[4-(cyclopropylamino)-4-oxobutyl]carbamoylamino]-3-methylbutanoic acid (PubChem CID 81070939) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is 4-[[4-(cyclopropylamino)-4-oxobutyl]carbamoylamino]-3-methylbutanoic acid.
| Compound Name | 4-[[4-(cyclopropylamino)-4-oxobutyl]carbamoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 81070939 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 4-[[4-(cyclopropylamino)-4-oxobutyl]carbamoylamino]-3-methylbutanoic acid |
| SMILES | CC(CNC(=O)NCCCC(=O)NC1CC1)CC(=O)O |
| InChI | InChI=1S/C13H23N3O4/c1-9(7-12(18)19)8-15-13(20)14-6-2-3-11(17)16-10-4-5-10/h9-10H,2-8H2,1H3,(H,16,17)(H,18,19)(H2,14,15,20) |
| InChIKey | GDWYHHIREVULNT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|