C9H17N3O2 — CID 115582642
N-cyclopropyl-4-(methylcarbamoylamino)butanamide (PubChem CID 115582642) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is N-cyclopropyl-4-(methylcarbamoylamino)butanamide.
| Compound Name | N-cyclopropyl-4-(methylcarbamoylamino)butanamide |
|---|---|
| PubChem CID | 115582642 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | N-cyclopropyl-4-(methylcarbamoylamino)butanamide |
| SMILES | CNC(=O)NCCCC(=O)NC1CC1 |
| InChI | InChI=1S/C9H17N3O2/c1-10-9(14)11-6-2-3-8(13)12-7-4-5-7/h7H,2-6H2,1H3,(H,12,13)(H2,10,11,14) |
| InChIKey | ZEHOEKGWTBKVBH-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|